C9H10N4S — CID 63831910
N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine (PubChem CID 63831910) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine.
| Compound Name | N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63831910 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | N-[2-(1,3-thiazol-4-yl)ethyl]pyrimidin-4-amine |
| SMILES | c1cc(NCCc2cscn2)ncn1 |
| InChI | InChI=1S/C9H10N4S/c1(8-5-14-7-13-8)4-11-9-2-3-10-6-12-9/h2-3,5-7H,1,4H2,(H,10,11,12) |
| InChIKey | XUFNAKPSQQAUNC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |