C11H12N4S2 — CID 63826078
6-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-3-carbothioamide (PubChem CID 63826078) has the molecular formula C11H12N4S2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 6-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-3-carbothioamide.
| Compound Name | 6-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 63826078 |
| Molecular Formula | C11H12N4S2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(NCCc2cscn2)nc1 |
| InChI | InChI=1S/C11H12N4S2/c12-11(16)8-1-2-10(14-5-8)13-4-3-9-6-17-7-15-9/h1-2,5-7H,3-4H2,(H2,12,16)(H,13,14) |
| InChIKey | JQTGVVSVTYOJLI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|