C10H16N4O2S — CID 80798105
methyl 3-[[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanoate (PubChem CID 80798105) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is methyl 3-[[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanoate.
| Compound Name | methyl 3-[[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 80798105 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | methyl 3-[[6-(methylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanoate |
| SMILES | CNc1cc(NCCC(=O)OC)nc(SC)n1 |
| InChI | InChI=1S/C10H16N4O2S/c1-11-7-6-8(14-10(13-7)17-3)12-5-4-9(15)16-2/h6H,4-5H2,1-3H3,(H2,11,12,13,14) |
| InChIKey | MKZGIGJJHUHSBL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |