C11H15BrF3N3S — CID 106432146
6-bromo-2-tert-butyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine (PubChem CID 106432146) has the molecular formula C11H15BrF3N3S and a molecular weight of 358.23 g/mol. Its IUPAC name is 6-bromo-2-tert-butyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-bromo-2-tert-butyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106432146 |
| Molecular Formula | C11H15BrF3N3S |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 6-bromo-2-tert-butyl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-4-amine |
| SMILES | CC(C)(C)c1nc(Br)cc(NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C11H15BrF3N3S/c1-10(2,3)9-17-7(12)6-8(18-9)16-4-5-19-11(13,14)15/h6H,4-5H2,1-3H3,(H,16,17,18) |
| InChIKey | QIIBPVARVYFLHX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|