C14H16BrNO — CID 54863650
4-bromo-2,6-dimethyl-N-[(5-methylfuran-2-yl)methyl]aniline (PubChem CID 54863650) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is 4-bromo-2,6-dimethyl-N-[(5-methylfuran-2-yl)methyl]aniline.
| Compound Name | 4-bromo-2,6-dimethyl-N-[(5-methylfuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 54863650 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 4-bromo-2,6-dimethyl-N-[(5-methylfuran-2-yl)methyl]aniline |
| SMILES | Cc1ccc(CNc2c(C)cc(Br)cc2C)o1 |
| InChI | InChI=1S/C14H16BrNO/c1-9-6-12(15)7-10(2)14(9)16-8-13-5-4-11(3)17-13/h4-7,16H,8H2,1-3H3 |
| InChIKey | WLBDTXQMDSGNIW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |