C19H19NO3 — CID 20921748
3-[(5-methylfuran-2-yl)methylamino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 20921748) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[(5-methylfuran-2-yl)methylamino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(5-methylfuran-2-yl)methylamino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20921748 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-[(5-methylfuran-2-yl)methylamino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(CNc2c(-c3cc(C)c(C)cc3C)c(=O)c2=O)o1 |
| InChI | InChI=1S/C19H19NO3/c1-10-7-12(3)15(8-11(10)2)16-17(19(22)18(16)21)20-9-14-6-5-13(4)23-14/h5-8,20H,9H2,1-4H3 |
| InChIKey | LMRHBEDPXRTAID-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|