C20H18ClNO2 — CID 20921703
3-(3-chloro-2-methylanilino)-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione (PubChem CID 20921703) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is 3-(3-chloro-2-methylanilino)-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3-chloro-2-methylanilino)-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20921703 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 3-(3-chloro-2-methylanilino)-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1cc(C)c(-c2c(Nc3cccc(Cl)c3C)c(=O)c2=O)cc1C |
| InChI | InChI=1S/C20H18ClNO2/c1-10-8-12(3)14(9-11(10)2)17-18(20(24)19(17)23)22-16-7-5-6-15(21)13(16)4/h5-9,22H,1-4H3 |
| InChIKey | QEPCZNPVQZMXGG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|