C11H13ClN4 — CID 115468972
4-chloro-2-N-[(2-methylpyrazol-3-yl)methyl]benzene-1,2-diamine (PubChem CID 115468972) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 4-chloro-2-N-[(2-methylpyrazol-3-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-[(2-methylpyrazol-3-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115468972 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-chloro-2-N-[(2-methylpyrazol-3-yl)methyl]benzene-1,2-diamine |
| SMILES | Cn1nccc1CNc1cc(Cl)ccc1N |
| InChI | InChI=1S/C11H13ClN4/c1-16-9(4-5-15-16)7-14-11-6-8(12)2-3-10(11)13/h2-6,14H,7,13H2,1H3 |
| InChIKey | LZQPGBILUGUXGQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|