C19H28N4O3 — CID 32665247
(2S)-2-[2-ethoxy-4-[(2-imidazol-1-ylethylamino)methyl]phenoxy]-N,N-dimethylpropanamide (PubChem CID 32665247) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is (2S)-2-[2-ethoxy-4-[(2-imidazol-1-ylethylamino)methyl]phenoxy]-N,N-dimethylpropanamide.
| Compound Name | (2S)-2-[2-ethoxy-4-[(2-imidazol-1-ylethylamino)methyl]phenoxy]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 32665247 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (2S)-2-[2-ethoxy-4-[(2-imidazol-1-ylethylamino)methyl]phenoxy]-N,N-dimethylpropanamide |
| SMILES | CCOc1cc(CNCCn2ccnc2)ccc1O[C@@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C19H28N4O3/c1-5-25-18-12-16(13-20-8-10-23-11-9-21-14-23)6-7-17(18)26-15(2)19(24)22(3)4/h6-7,9,11-12,14-15,20H,5,8,10,13H2,1-4H3/t15-/m0/s1 |
| InChIKey | SAOHJNMADRLTRL-HNNXBMFYSA-N |
| XLogP | 1.93 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|