C14H22N2O3 — CID 43122479
2-[4-(aminomethyl)-2-ethoxyphenoxy]-N,N-dimethylpropanamide (PubChem CID 43122479) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-ethoxyphenoxy]-N,N-dimethylpropanamide.
| Compound Name | 2-[4-(aminomethyl)-2-ethoxyphenoxy]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43122479 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[4-(aminomethyl)-2-ethoxyphenoxy]-N,N-dimethylpropanamide |
| SMILES | CCOc1cc(CN)ccc1OC(C)C(=O)N(C)C |
| InChI | InChI=1S/C14H22N2O3/c1-5-18-13-8-11(9-15)6-7-12(13)19-10(2)14(17)16(3)4/h6-8,10H,5,9,15H2,1-4H3 |
| InChIKey | OGZZUWJSUKVSHY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |