C16H21N5O4S — CID 77088639
N-[2-(dimethylamino)-2-oxoethyl]-3-(2-imidazol-1-ylethylsulfamoyl)benzamide (PubChem CID 77088639) has the molecular formula C16H21N5O4S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-3-(2-imidazol-1-ylethylsulfamoyl)benzamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-3-(2-imidazol-1-ylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 77088639 |
| Molecular Formula | C16H21N5O4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-3-(2-imidazol-1-ylethylsulfamoyl)benzamide |
| SMILES | CN(C)C(=O)CNC(=O)c1cccc(S(=O)(=O)NCCn2ccnc2)c1 |
| InChI | InChI=1S/C16H21N5O4S/c1-20(2)15(22)11-18-16(23)13-4-3-5-14(10-13)26(24,25)19-7-9-21-8-6-17-12-21/h3-6,8,10,12,19H,7,9,11H2,1-2H3,(H,18,23) |
| InChIKey | KGSNPCNXKAEURH-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |