C20H26N6O2 — CID 58654367
5-[[2-[1-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)ethylamino]ethylamino]methyl]-2-methoxyphenol (PubChem CID 58654367) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 5-[[2-[1-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)ethylamino]ethylamino]methyl]-2-methoxyphenol.
| Compound Name | 5-[[2-[1-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)ethylamino]ethylamino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 58654367 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 5-[[2-[1-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)ethylamino]ethylamino]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CNCCNC(C)c2cc(C)nc(-n3ccnc3)n2)cc1O |
| InChI | InChI=1S/C20H26N6O2/c1-14-10-17(25-20(24-14)26-9-8-22-13-26)15(2)23-7-6-21-12-16-4-5-19(28-3)18(27)11-16/h4-5,8-11,13,15,21,23,27H,6-7,12H2,1-3H3 |
| InChIKey | SFOAGZXGHGUXQC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|