C17H21NO2 — CID 81349097
2-methoxy-5-[[[(1S)-1-(4-methylphenyl)ethyl]amino]methyl]phenol (PubChem CID 81349097) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-methoxy-5-[[[(1S)-1-(4-methylphenyl)ethyl]amino]methyl]phenol.
| Compound Name | 2-methoxy-5-[[[(1S)-1-(4-methylphenyl)ethyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 81349097 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-methoxy-5-[[[(1S)-1-(4-methylphenyl)ethyl]amino]methyl]phenol |
| SMILES | COc1ccc(CN[C@@H](C)c2ccc(C)cc2)cc1O |
| InChI | InChI=1S/C17H21NO2/c1-12-4-7-15(8-5-12)13(2)18-11-14-6-9-17(20-3)16(19)10-14/h4-10,13,18-19H,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | PUXITXLVZOQCNN-ZDUSSCGKSA-N |
| XLogP | 3.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |