C15H20ClNO3 — CID 47008363
2-methoxy-5-[[1-(5-methylfuran-2-yl)ethylamino]methyl]phenol;hydrochloride (PubChem CID 47008363) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 2-methoxy-5-[[1-(5-methylfuran-2-yl)ethylamino]methyl]phenol;hydrochloride.
| Compound Name | 2-methoxy-5-[[1-(5-methylfuran-2-yl)ethylamino]methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 47008363 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-methoxy-5-[[1-(5-methylfuran-2-yl)ethylamino]methyl]phenol;hydrochloride |
| SMILES | COc1ccc(CNC(C)c2ccc(C)o2)cc1O.Cl |
| InChI | InChI=1S/C15H19NO3.ClH/c1-10-4-6-14(19-10)11(2)16-9-12-5-7-15(18-3)13(17)8-12;/h4-8,11,16-17H,9H2,1-3H3;1H |
| InChIKey | OUBLIIGILCMVKM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |