About 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride
1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride (PubChem CID 47008361) has the molecular formula C17H24ClNO4
and a molecular weight of 341.84 g/mol. Its IUPAC name is 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride |
| PubChem CID | 47008361 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride |
| SMILES | COc1cc(OC)c(OC)cc1CNC(C)c1ccc(C)o1.Cl |
| InChI | InChI=1S/C17H23NO4.ClH/c1-11-6-7-14(22-11)12(2)18-10-13-8-16(20-4)17(21-5)9-15(13)19-3;/h6-9,12,18H,10H2,1-5H3;1H |
| InChIKey | VYGUTEXXHNLIHK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride?
The IUPAC name of 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride (CID 47008361) is 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride.
What is the SMILES notation for 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride?
The canonical SMILES for 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride is COc1cc(OC)c(OC)cc1CNC(C)c1ccc(C)o1.Cl.
What is the InChIKey of 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride?
The InChIKey is VYGUTEXXHNLIHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4.ClH/c1-11-6-7-14(22-11)12(2)18-10-13-8-16(20-4)17(21-5)9-15(13)19-3;/h6-9,12,18H,10H2,1-5H3;1H.
What are the key properties of 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride?
1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride has a molecular weight of 341.84 g/mol, XLogP of 3.89, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methylfuran-2-yl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine;hydrochloride is sourced from PubChem (CID 47008361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).