C10H10N4O2S2 — CID 114166204
5-cyano-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide (PubChem CID 114166204) has the molecular formula C10H10N4O2S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 5-cyano-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114166204 |
| Molecular Formula | C10H10N4O2S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 5-cyano-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1[nH]ncc1CNS(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C10H10N4O2S2/c1-7-8(5-12-14-7)6-13-18(15,16)10-3-2-9(4-11)17-10/h2-3,5,13H,6H2,1H3,(H,12,14) |
| InChIKey | VXBZSUADEGZLCT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |