C9H9N5O2S2 — CID 106272939
N-[(5-amino-1H-pyrazol-4-yl)methyl]-5-cyanothiophene-2-sulfonamide (PubChem CID 106272939) has the molecular formula C9H9N5O2S2 and a molecular weight of 283.34 g/mol. Its IUPAC name is N-[(5-amino-1H-pyrazol-4-yl)methyl]-5-cyanothiophene-2-sulfonamide.
| Compound Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-5-cyanothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106272939 |
| Molecular Formula | C9H9N5O2S2 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-5-cyanothiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCc2cn[nH]c2N)s1 |
| InChI | InChI=1S/C9H9N5O2S2/c10-3-7-1-2-8(17-7)18(15,16)13-5-6-4-12-14-9(6)11/h1-2,4,13H,5H2,(H3,11,12,14) |
| InChIKey | BXEXAQRNECUZAQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |