C11H13N3O2S2 — CID 114698293
4-amino-N-[(3-methyl-4-pyridinyl)methyl]thiophene-2-sulfonamide (PubChem CID 114698293) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-amino-N-[(3-methyl-4-pyridinyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-[(3-methyl-4-pyridinyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114698293 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-amino-N-[(3-methyl-4-pyridinyl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1cnccc1CNS(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C11H13N3O2S2/c1-8-5-13-3-2-9(8)6-14-18(15,16)11-4-10(12)7-17-11/h2-5,7,14H,6,12H2,1H3 |
| InChIKey | OBIXVBQNQYPDMA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |