C10H18N2O3S2 — CID 61301356
4-amino-N-(2-butoxyethyl)thiophene-2-sulfonamide (PubChem CID 61301356) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-amino-N-(2-butoxyethyl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-(2-butoxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61301356 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-amino-N-(2-butoxyethyl)thiophene-2-sulfonamide |
| SMILES | CCCCOCCNS(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C10H18N2O3S2/c1-2-3-5-15-6-4-12-17(13,14)10-7-9(11)8-16-10/h7-8,12H,2-6,11H2,1H3 |
| InChIKey | OHYXFSRDRJWBES-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|