About 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide
4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide (PubChem CID 63226058) has the molecular formula C7H9F3N2O2S2
and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide |
| PubChem CID | 63226058 |
| Molecular Formula | C7H9F3N2O2S2 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide |
| SMILES | Nc1csc(S(=O)(=O)NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C7H9F3N2O2S2/c8-7(9,10)1-2-12-16(13,14)6-3-5(11)4-15-6/h3-4,12H,1-2,11H2 |
| InChIKey | LIZXATPAOFJGPU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide?
The IUPAC name of 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide (CID 63226058) is 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide.
What is the SMILES notation for 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide?
The canonical SMILES for 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide is Nc1csc(S(=O)(=O)NCCC(F)(F)F)c1.
What is the InChIKey of 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide?
The InChIKey is LIZXATPAOFJGPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2O2S2/c8-7(9,10)1-2-12-16(13,14)6-3-5(11)4-15-6/h3-4,12H,1-2,11H2.
What are the key properties of 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide?
4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide has a molecular weight of 274.29 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide is sourced from PubChem (CID 63226058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).