C7H9F3N2O2S2 — CID 63226058
4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide (PubChem CID 63226058) has the molecular formula C7H9F3N2O2S2 and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 63226058 |
| Molecular Formula | C7H9F3N2O2S2 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 4-amino-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide |
| SMILES | Nc1csc(S(=O)(=O)NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C7H9F3N2O2S2/c8-7(9,10)1-2-12-16(13,14)6-3-5(11)4-15-6/h3-4,12H,1-2,11H2 |
| InChIKey | LIZXATPAOFJGPU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |