C10H12F3N3O3S — CID 122094408
4-[[4-(2,2,2-trifluoroethyl)-1,3-thiazol-2-yl]carbamoylamino]butanoic acid (PubChem CID 122094408) has the molecular formula C10H12F3N3O3S and a molecular weight of 311.29 g/mol. Its IUPAC name is 4-[[4-(2,2,2-trifluoroethyl)-1,3-thiazol-2-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[4-(2,2,2-trifluoroethyl)-1,3-thiazol-2-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122094408 |
| Molecular Formula | C10H12F3N3O3S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-[[4-(2,2,2-trifluoroethyl)-1,3-thiazol-2-yl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1nc(CC(F)(F)F)cs1 |
| InChI | InChI=1S/C10H12F3N3O3S/c11-10(12,13)4-6-5-20-9(15-6)16-8(19)14-3-1-2-7(17)18/h5H,1-4H2,(H,17,18)(H2,14,15,16,19) |
| InChIKey | RWASXFLAQWXDIY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|