C15H14N6OS — CID 167908478
3-(3-but-3-ynyldiazirin-3-yl)-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 167908478) has the molecular formula C15H14N6OS and a molecular weight of 326.38 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 167908478 |
| Molecular Formula | C15H14N6OS |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | C#CCCC1(CCC(=O)Nc2nnc(-c3ccncc3)s2)N=N1 |
| InChI | InChI=1S/C15H14N6OS/c1-2-3-7-15(20-21-15)8-4-12(22)17-14-19-18-13(23-14)11-5-9-16-10-6-11/h1,5-6,9-10H,3-4,7-8H2,(H,17,19,22) |
| InChIKey | IWWBXYSMIPKZLL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|