C21H25N5O2 — CID 55867665
2,6-dimethyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]quinoline-3-carboxamide (PubChem CID 55867665) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2,6-dimethyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]quinoline-3-carboxamide.
| Compound Name | 2,6-dimethyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 55867665 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2,6-dimethyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]quinoline-3-carboxamide |
| SMILES | Cc1ccc2nc(C)c(C(=O)NCCCn3nc4n(c3=O)CCCC4)cc2c1 |
| InChI | InChI=1S/C21H25N5O2/c1-14-7-8-18-16(12-14)13-17(15(2)23-18)20(27)22-9-5-11-26-21(28)25-10-4-3-6-19(25)24-26/h7-8,12-13H,3-6,9-11H2,1-2H3,(H,22,27) |
| InChIKey | KSDFREVCIOIBKE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|