C18H22IN5O3 — CID 55867409
2-iodo-N-[2-oxo-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]ethyl]benzamide (PubChem CID 55867409) has the molecular formula C18H22IN5O3 and a molecular weight of 483.31 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-oxo-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 55867409 |
| Molecular Formula | C18H22IN5O3 |
| Molecular Weight | 483.31 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1I)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C18H22IN5O3/c19-14-7-2-1-6-13(14)17(26)21-12-16(25)20-9-5-11-24-18(27)23-10-4-3-8-15(23)22-24/h1-2,6-7H,3-5,8-12H2,(H,20,25)(H,21,26) |
| InChIKey | ZLMWFJCMZNGNAB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|