C18H27N5O2S — CID 55858592
2-butyl-4-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,3-thiazole-5-carboxamide (PubChem CID 55858592) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-butyl-4-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-butyl-4-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55858592 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-butyl-4-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCCCc1nc(C)c(C(=O)NCCCn2nc3n(c2=O)CCCC3)s1 |
| InChI | InChI=1S/C18H27N5O2S/c1-3-4-9-15-20-13(2)16(26-15)17(24)19-10-7-12-23-18(25)22-11-6-5-8-14(22)21-23/h3-12H2,1-2H3,(H,19,24) |
| InChIKey | QOSBYLFDIICCAJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|