C17H28N6O3 — CID 96559228
4-acetyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,4-diazepane-1-carboxamide (PubChem CID 96559228) has the molecular formula C17H28N6O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-acetyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-acetyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 96559228 |
| Molecular Formula | C17H28N6O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-acetyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,4-diazepane-1-carboxamide |
| SMILES | CC(=O)N1CCCN(C(=O)NCCCn2nc3n(c2=O)CCCC3)CC1 |
| InChI | InChI=1S/C17H28N6O3/c1-14(24)20-8-5-9-21(13-12-20)16(25)18-7-4-11-23-17(26)22-10-3-2-6-15(22)19-23/h2-13H2,1H3,(H,18,25) |
| InChIKey | BSJINIRQNWOVCT-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|