C17H31N7O2 — CID 111385454
N-tert-butyl-2-[[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]acetamide (PubChem CID 111385454) has the molecular formula C17H31N7O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111385454 |
| Molecular Formula | C17H31N7O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCCn1nc2n(c1=O)CCCC2)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H31N7O2/c1-17(2,3)21-14(25)12-20-15(18-4)19-9-7-11-24-16(26)23-10-6-5-8-13(23)22-24/h5-12H2,1-4H3,(H,21,25)(H2,18,19,20) |
| InChIKey | RTJVLARMNNMBJP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|