C20H35N7O2 — CID 111569871
N,N-dimethyl-1-[[[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide (PubChem CID 111569871) has the molecular formula C20H35N7O2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N,N-dimethyl-1-[[[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide.
| Compound Name | N,N-dimethyl-1-[[[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111569871 |
| Molecular Formula | C20H35N7O2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | N,N-dimethyl-1-[[[N'-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide |
| SMILES | C/N=C(/NCCCn1nc2n(c1=O)CCCC2)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C20H35N7O2/c1-21-18(23-15-20(10-5-6-11-20)17(28)25(2)3)22-12-8-14-27-19(29)26-13-7-4-9-16(26)24-27/h4-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | MFLPJABYIOUZSH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|