C20H26BrClFNO3 — CID 17290632
N-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride (PubChem CID 17290632) has the molecular formula C20H26BrClFNO3 and a molecular weight of 462.79 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17290632 |
| Molecular Formula | C20H26BrClFNO3 |
| Molecular Weight | 462.79 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | N-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
| SMILES | CCOCCCNCc1cc(Br)c(OCc2ccccc2F)c(OC)c1.Cl |
| InChI | InChI=1S/C20H25BrFNO3.ClH/c1-3-25-10-6-9-23-13-15-11-17(21)20(19(12-15)24-2)26-14-16-7-4-5-8-18(16)22;/h4-5,7-8,11-12,23H,3,6,9-10,13-14H2,1-2H3;1H |
| InChIKey | WJFDILQIPLKGBH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|