C21H27BrClNO5 — CID 17057235
N-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-methoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride (PubChem CID 17057235) has the molecular formula C21H27BrClNO5 and a molecular weight of 488.81 g/mol. Its IUPAC name is N-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-methoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride.
| Compound Name | N-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-methoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17057235 |
| Molecular Formula | C21H27BrClNO5 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | N-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-methoxyphenyl]methyl]-3-ethoxypropan-1-amine;hydrochloride |
| SMILES | CCOCCCNCc1cc(Br)c(OCc2ccc3c(c2)OCO3)c(OC)c1.Cl |
| InChI | InChI=1S/C21H26BrNO5.ClH/c1-3-25-8-4-7-23-12-16-9-17(22)21(20(11-16)24-2)26-13-15-5-6-18-19(10-15)28-14-27-18;/h5-6,9-11,23H,3-4,7-8,12-14H2,1-2H3;1H |
| InChIKey | WLVSQFRITFYIPN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|