C23H30BrNO4 — CID 17057376
N-[[3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-5-methoxyphenyl]methyl]hexan-1-amine (PubChem CID 17057376) has the molecular formula C23H30BrNO4 and a molecular weight of 464.40 g/mol. Its IUPAC name is N-[[3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-5-methoxyphenyl]methyl]hexan-1-amine.
| Compound Name | N-[[3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-5-methoxyphenyl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 17057376 |
| Molecular Formula | C23H30BrNO4 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-[[3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-5-methoxyphenyl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1cc(Br)c(OCc2ccc3c(c2)OCCO3)c(OC)c1 |
| InChI | InChI=1S/C23H30BrNO4/c1-3-4-5-6-9-25-15-18-12-19(24)23(22(14-18)26-2)29-16-17-7-8-20-21(13-17)28-11-10-27-20/h7-8,12-14,25H,3-6,9-11,15-16H2,1-2H3 |
| InChIKey | KRBSPYOURGRCAM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|