C19H23BrClNO5 — CID 17057337
2-[[3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-5-methoxyphenyl]methylamino]ethanol;hydrochloride (PubChem CID 17057337) has the molecular formula C19H23BrClNO5 and a molecular weight of 460.75 g/mol. Its IUPAC name is 2-[[3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-5-methoxyphenyl]methylamino]ethanol;hydrochloride.
| Compound Name | 2-[[3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-5-methoxyphenyl]methylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17057337 |
| Molecular Formula | C19H23BrClNO5 |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 2-[[3-bromo-4-(2,3-dihydro-1,4-benzodioxin-6-ylmethoxy)-5-methoxyphenyl]methylamino]ethanol;hydrochloride |
| SMILES | COc1cc(CNCCO)cc(Br)c1OCc1ccc2c(c1)OCCO2.Cl |
| InChI | InChI=1S/C19H22BrNO5.ClH/c1-23-18-10-14(11-21-4-5-22)8-15(20)19(18)26-12-13-2-3-16-17(9-13)25-7-6-24-16;/h2-3,8-10,21-22H,4-7,11-12H2,1H3;1H |
| InChIKey | VXGRCRRMAAJPIW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|