C23H30BrNO5 — CID 17057490
1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[(hexylamino)methyl]-6-methoxyphenoxy]ethanol (PubChem CID 17057490) has the molecular formula C23H30BrNO5 and a molecular weight of 480.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[(hexylamino)methyl]-6-methoxyphenoxy]ethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[(hexylamino)methyl]-6-methoxyphenoxy]ethanol |
|---|---|
| PubChem CID | 17057490 |
| Molecular Formula | C23H30BrNO5 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[(hexylamino)methyl]-6-methoxyphenoxy]ethanol |
| SMILES | CCCCCCNCc1cc(Br)c(OCC(O)c2ccc3c(c2)OCO3)c(OC)c1 |
| InChI | InChI=1S/C23H30BrNO5/c1-3-4-5-6-9-25-13-16-10-18(24)23(22(11-16)27-2)28-14-19(26)17-7-8-20-21(12-17)30-15-29-20/h7-8,10-12,19,25-26H,3-6,9,13-15H2,1-2H3 |
| InChIKey | QVVVSRWKYXOMNE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|