C27H30BrNO7 — CID 17057486
1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxyphenoxy]ethanol (PubChem CID 17057486) has the molecular formula C27H30BrNO7 and a molecular weight of 560.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxyphenoxy]ethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxyphenoxy]ethanol |
|---|---|
| PubChem CID | 17057486 |
| Molecular Formula | C27H30BrNO7 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]-6-methoxyphenoxy]ethanol |
| SMILES | COc1ccc(CCNCc2cc(Br)c(OCC(O)c3ccc4c(c3)OCO4)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H30BrNO7/c1-31-22-6-4-17(11-24(22)32-2)8-9-29-14-18-10-20(28)27(26(12-18)33-3)34-15-21(30)19-5-7-23-25(13-19)36-16-35-23/h4-7,10-13,21,29-30H,8-9,14-16H2,1-3H3 |
| InChIKey | APSUQQURJXQBHE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|