C27H28BrClN2O5 — CID 17057513
1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyphenoxy]ethanol;hydrochloride (PubChem CID 17057513) has the molecular formula C27H28BrClN2O5 and a molecular weight of 575.89 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyphenoxy]ethanol;hydrochloride.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyphenoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17057513 |
| Molecular Formula | C27H28BrClN2O5 |
| Molecular Weight | 575.89 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[2-bromo-4-[[2-(1H-indol-3-yl)ethylamino]methyl]-6-methoxyphenoxy]ethanol;hydrochloride |
| SMILES | COc1cc(CNCCc2c[nH]c3ccccc23)cc(Br)c1OCC(O)c1ccc2c(c1)OCO2.Cl |
| InChI | InChI=1S/C27H27BrN2O5.ClH/c1-32-26-11-17(13-29-9-8-19-14-30-22-5-3-2-4-20(19)22)10-21(28)27(26)33-15-23(31)18-6-7-24-25(12-18)35-16-34-24;/h2-7,10-12,14,23,29-31H,8-9,13,15-16H2,1H3;1H |
| InChIKey | DQRHMVCBUDKHJY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.89 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|