C20H25BrFNO4 — CID 17155252
2-[2-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol (PubChem CID 17155252) has the molecular formula C20H25BrFNO4 and a molecular weight of 442.33 g/mol. Its IUPAC name is 2-[2-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 17155252 |
| Molecular Formula | C20H25BrFNO4 |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-[2-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]ethoxy]ethanol |
| SMILES | CCOc1cc(CNCCOCCO)cc(Br)c1OCc1ccccc1F |
| InChI | InChI=1S/C20H25BrFNO4/c1-2-26-19-12-15(13-23-7-9-25-10-8-24)11-17(21)20(19)27-14-16-5-3-4-6-18(16)22/h3-6,11-12,23-24H,2,7-10,13-14H2,1H3 |
| InChIKey | TWQRJILLAKOVAD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|