C22H37BrN2O2 — CID 17214767
N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-N',N'-dibutylpropane-1,3-diamine (PubChem CID 17214767) has the molecular formula C22H37BrN2O2 and a molecular weight of 441.45 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-N',N'-dibutylpropane-1,3-diamine.
| Compound Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-N',N'-dibutylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17214767 |
| Molecular Formula | C22H37BrN2O2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-N',N'-dibutylpropane-1,3-diamine |
| SMILES | C=CCOc1c(Br)cc(CNCCCN(CCCC)CCCC)cc1OC |
| InChI | InChI=1S/C22H37BrN2O2/c1-5-8-12-25(13-9-6-2)14-10-11-24-18-19-16-20(23)22(27-15-7-3)21(17-19)26-4/h7,16-17,24H,3,5-6,8-15,18H2,1-2,4H3 |
| InChIKey | IZAQNWWPFIWNRG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|