C18H22Br2ClNO2 — CID 17158148
N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 17158148) has the molecular formula C18H22Br2ClNO2 and a molecular weight of 479.64 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17158148 |
| Molecular Formula | C18H22Br2ClNO2 |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | CCOc1c(Br)cc(CNCCc2ccc(OC)cc2)cc1Br.Cl |
| InChI | InChI=1S/C18H21Br2NO2.ClH/c1-3-23-18-16(19)10-14(11-17(18)20)12-21-9-8-13-4-6-15(22-2)7-5-13;/h4-7,10-11,21H,3,8-9,12H2,1-2H3;1H |
| InChIKey | WSFDIQPDMWABSH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|