C12H14BrF3O4 — CID 106705140
[3-bromo-5-ethoxy-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methanol (PubChem CID 106705140) has the molecular formula C12H14BrF3O4 and a molecular weight of 359.14 g/mol. Its IUPAC name is [3-bromo-5-ethoxy-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methanol.
| Compound Name | [3-bromo-5-ethoxy-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 106705140 |
| Molecular Formula | C12H14BrF3O4 |
| Molecular Weight | 359.14 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | [3-bromo-5-ethoxy-4-(2,2,2-trifluoroethoxymethoxy)phenyl]methanol |
| SMILES | CCOc1cc(CO)cc(Br)c1OCOCC(F)(F)F |
| InChI | InChI=1S/C12H14BrF3O4/c1-2-19-10-4-8(5-17)3-9(13)11(10)20-7-18-6-12(14,15)16/h3-4,17H,2,5-7H2,1H3 |
| InChIKey | SMFFBENBTBAHBE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.14 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|