C15H15F3N2O3 — CID 22485528
6-[3,5-dimethoxy-4-(2,2,2-trifluoroethoxy)phenyl]pyridin-3-amine (PubChem CID 22485528) has the molecular formula C15H15F3N2O3 and a molecular weight of 328.29 g/mol. Its IUPAC name is 6-[3,5-dimethoxy-4-(2,2,2-trifluoroethoxy)phenyl]pyridin-3-amine.
| Compound Name | 6-[3,5-dimethoxy-4-(2,2,2-trifluoroethoxy)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 22485528 |
| Molecular Formula | C15H15F3N2O3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 6-[3,5-dimethoxy-4-(2,2,2-trifluoroethoxy)phenyl]pyridin-3-amine |
| SMILES | COc1cc(-c2ccc(N)cn2)cc(OC)c1OCC(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O3/c1-21-12-5-9(11-4-3-10(19)7-20-11)6-13(22-2)14(12)23-8-15(16,17)18/h3-7H,8,19H2,1-2H3 |
| InChIKey | LFXYXJDRIXGEIX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |