C20H16Br4N2O2Zn — CID 139072224
zinc bis(2,4-dibromo-6-(cyclopropyliminomethyl)phenolate) (PubChem CID 139072224) has the molecular formula C20H16Br4N2O2Zn and a molecular weight of 701.37 g/mol. Its IUPAC name is zinc bis(2,4-dibromo-6-(cyclopropyliminomethyl)phenolate).
| Compound Name | zinc bis(2,4-dibromo-6-(cyclopropyliminomethyl)phenolate) |
|---|---|
| PubChem CID | 139072224 |
| Molecular Formula | C20H16Br4N2O2Zn |
| Molecular Weight | 701.37 g/mol |
| Exact Mass | 695.72 |
| IUPAC Name | zinc bis(2,4-dibromo-6-(cyclopropyliminomethyl)phenolate) |
| SMILES | [O-]c1c(Br)cc(Br)cc1/C=N/C1CC1.[O-]c1c(Br)cc(Br)cc1/C=N/C1CC1.[Zn+2] |
| InChI | InChI=1S/2C10H9Br2NO.Zn/c2*11-7-3-6(5-13-8-1-2-8)10(14)9(12)4-7;/h2*3-5,8,14H,1-2H2;/q;;+2/p-2/b2*13-5+; |
| InChIKey | ZPSLHEHKTPWUMV-ZPYWNHNTSA-L |
| XLogP | 5.73 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.37 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|