C22H24Br2N2O4 — CID 174983508
N-[2,4-dibromo-6-[(4-hydroxycyclohexyl)iminomethyl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 174983508) has the molecular formula C22H24Br2N2O4 and a molecular weight of 540.25 g/mol. Its IUPAC name is N-[2,4-dibromo-6-[(4-hydroxycyclohexyl)iminomethyl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2,4-dibromo-6-[(4-hydroxycyclohexyl)iminomethyl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 174983508 |
| Molecular Formula | C22H24Br2N2O4 |
| Molecular Weight | 540.25 g/mol |
| Exact Mass | 538.01 |
| IUPAC Name | N-[2,4-dibromo-6-[(4-hydroxycyclohexyl)iminomethyl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Br)cc(Br)cc2/C=N/C2CCC(O)CC2)cc1OC |
| InChI | InChI=1S/C22H24Br2N2O4/c1-29-19-8-3-13(10-20(19)30-2)22(28)26-21-14(9-15(23)11-18(21)24)12-25-16-4-6-17(27)7-5-16/h3,8-12,16-17,27H,4-7H2,1-2H3,(H,26,28)/b25-12+ |
| InChIKey | BTQDWPCUFQOLIP-BRJLIKDPSA-N |
| XLogP | 5.20 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|