C23H23BrN3O2+ — CID 3680754
dibenzyl-[2-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]azanium (PubChem CID 3680754) has the molecular formula C23H23BrN3O2+ and a molecular weight of 453.36 g/mol. Its IUPAC name is dibenzyl-[2-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]azanium.
| Compound Name | dibenzyl-[2-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 3680754 |
| Molecular Formula | C23H23BrN3O2+ |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | dibenzyl-[2-[2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]azanium |
| SMILES | O=C(C[NH+](Cc1ccccc1)Cc1ccccc1)NN=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C23H22BrN3O2/c24-21-11-12-22(28)20(13-21)14-25-26-23(29)17-27(15-18-7-3-1-4-8-18)16-19-9-5-2-6-10-19/h1-14,28H,15-17H2,(H,26,29)/p+1 |
| InChIKey | CKUQCHUYICYFGQ-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|