C31H52N2O2Si4 — CID 137124781
2-[[3-[[2-hydroxy-3,5-bis(trimethylsilyl)phenyl]methylideneamino]cyclopentyl]iminomethyl]-4,6-bis(trimethylsilyl)phenol (PubChem CID 137124781) has the molecular formula C31H52N2O2Si4 and a molecular weight of 597.11 g/mol. Its IUPAC name is 2-[[3-[[2-hydroxy-3,5-bis(trimethylsilyl)phenyl]methylideneamino]cyclopentyl]iminomethyl]-4,6-bis(trimethylsilyl)phenol.
| Compound Name | 2-[[3-[[2-hydroxy-3,5-bis(trimethylsilyl)phenyl]methylideneamino]cyclopentyl]iminomethyl]-4,6-bis(trimethylsilyl)phenol |
|---|---|
| PubChem CID | 137124781 |
| Molecular Formula | C31H52N2O2Si4 |
| Molecular Weight | 597.11 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 2-[[3-[[2-hydroxy-3,5-bis(trimethylsilyl)phenyl]methylideneamino]cyclopentyl]iminomethyl]-4,6-bis(trimethylsilyl)phenol |
| SMILES | C[Si](C)(C)c1cc(/C=N/C2CCC(/N=C/c3cc([Si](C)(C)C)cc([Si](C)(C)C)c3O)C2)c(O)c([Si](C)(C)C)c1 |
| InChI | InChI=1S/C31H52N2O2Si4/c1-36(2,3)26-15-22(30(34)28(18-26)38(7,8)9)20-32-24-13-14-25(17-24)33-21-23-16-27(37(4,5)6)19-29(31(23)35)39(10,11)12/h15-16,18-21,24-25,34-35H,13-14,17H2,1-12H3/b32-20+,33-21+ |
| InChIKey | NAGVTZVGFDNVDS-YMQWWVFYSA-N |
| XLogP | 5.74 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.11 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|