C38H38N2OSi — CID 136711915
2-[(1-benzylpiperidin-4-yl)iminomethyl]-4-methyl-6-triphenylsilylphenol (PubChem CID 136711915) has the molecular formula C38H38N2OSi and a molecular weight of 566.82 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)iminomethyl]-4-methyl-6-triphenylsilylphenol.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)iminomethyl]-4-methyl-6-triphenylsilylphenol |
|---|---|
| PubChem CID | 136711915 |
| Molecular Formula | C38H38N2OSi |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)iminomethyl]-4-methyl-6-triphenylsilylphenol |
| SMILES | Cc1cc(/C=N/C2CCN(Cc3ccccc3)CC2)c(O)c([Si](c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C38H38N2OSi/c1-30-26-32(28-39-33-22-24-40(25-23-33)29-31-14-6-2-7-15-31)38(41)37(27-30)42(34-16-8-3-9-17-34,35-18-10-4-11-19-35)36-20-12-5-13-21-36/h2-21,26-28,33,41H,22-25,29H2,1H3/b39-28+ |
| InChIKey | JZFHKGKXHQULCV-MULCNKJOSA-N |
| XLogP | 5.16 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|