C20H24N4O2S — CID 145420207
1-(1-benzylpiperidin-4-yl)-3-[(E)-(2,3-dihydroxyphenyl)methylideneamino]thiourea (PubChem CID 145420207) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[(E)-(2,3-dihydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[(E)-(2,3-dihydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 145420207 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[(E)-(2,3-dihydroxyphenyl)methylideneamino]thiourea |
| SMILES | Oc1cccc(/C=N/NC(=S)NC2CCN(Cc3ccccc3)CC2)c1O |
| InChI | InChI=1S/C20H24N4O2S/c25-18-8-4-7-16(19(18)26)13-21-23-20(27)22-17-9-11-24(12-10-17)14-15-5-2-1-3-6-15/h1-8,13,17,25-26H,9-12,14H2,(H2,22,23,27)/b21-13+ |
| InChIKey | KACTXBZFANXHMK-FYJGNVAPSA-N |
| XLogP | 2.56 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|