C28H42N2O2Si2 — CID 137085239
2-[[3-[(2-hydroxy-3-methyl-5-trimethylsilylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-methyl-4-trimethylsilylphenol (PubChem CID 137085239) has the molecular formula C28H42N2O2Si2 and a molecular weight of 494.83 g/mol. Its IUPAC name is 2-[[3-[(2-hydroxy-3-methyl-5-trimethylsilylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-methyl-4-trimethylsilylphenol.
| Compound Name | 2-[[3-[(2-hydroxy-3-methyl-5-trimethylsilylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-methyl-4-trimethylsilylphenol |
|---|---|
| PubChem CID | 137085239 |
| Molecular Formula | C28H42N2O2Si2 |
| Molecular Weight | 494.83 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 2-[[3-[(2-hydroxy-3-methyl-5-trimethylsilylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-methyl-4-trimethylsilylphenol |
| SMILES | Cc1cc([Si](C)(C)C)cc(/C=N/C2CCCC(/N=C/c3cc([Si](C)(C)C)cc(C)c3O)C2)c1O |
| InChI | InChI=1S/C28H42N2O2Si2/c1-19-12-25(33(3,4)5)14-21(27(19)31)17-29-23-10-9-11-24(16-23)30-18-22-15-26(34(6,7)8)13-20(2)28(22)32/h12-15,17-18,23-24,31-32H,9-11,16H2,1-8H3/b29-17+,30-18+ |
| InChIKey | JHPIXTVBCINJLQ-YAGSLNJISA-N |
| XLogP | 5.65 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.83 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|