C32H46CuN4O4-2 — CID 5127710
copper;bis(2-[(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)iminomethyl]phenol) (PubChem CID 5127710) has the molecular formula C32H46CuN4O4-2 and a molecular weight of 614.29 g/mol. Its IUPAC name is copper;bis(2-[(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)iminomethyl]phenol).
| Compound Name | copper;bis(2-[(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)iminomethyl]phenol) |
|---|---|
| PubChem CID | 5127710 |
| Molecular Formula | C32H46CuN4O4-2 |
| Molecular Weight | 614.29 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | copper;bis(2-[(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)iminomethyl]phenol) |
| SMILES | CC1(C)CC(/N=C/c2ccccc2O)CC(C)(C)N1[O-].CC1(C)CC(/N=C/c2ccccc2O)CC(C)(C)N1[O-].[Cu] |
| InChI | InChI=1S/2C16H23N2O2.Cu/c2*1-15(2)9-13(10-16(3,4)18(15)20)17-11-12-7-5-6-8-14(12)19;/h2*5-8,11,13,19H,9-10H2,1-4H3;/q2*-1;/b2*17-11+; |
| InChIKey | NXAMAJRJDLRCAH-HPYVNBGCSA-N |
| XLogP | 6.66 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.29 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|