C17H26N2O — CID 137098911
2-[[(1S,3S)-3-(dimethylamino)-2,2,3-trimethylcyclopentyl]iminomethyl]phenol (PubChem CID 137098911) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-[[(1S,3S)-3-(dimethylamino)-2,2,3-trimethylcyclopentyl]iminomethyl]phenol.
| Compound Name | 2-[[(1S,3S)-3-(dimethylamino)-2,2,3-trimethylcyclopentyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137098911 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-[[(1S,3S)-3-(dimethylamino)-2,2,3-trimethylcyclopentyl]iminomethyl]phenol |
| SMILES | CN(C)[C@@]1(C)CC[C@H](/N=C/c2ccccc2O)C1(C)C |
| InChI | InChI=1S/C17H26N2O/c1-16(2)15(10-11-17(16,3)19(4)5)18-12-13-8-6-7-9-14(13)20/h6-9,12,15,20H,10-11H2,1-5H3/b18-12+/t15-,17-/m0/s1 |
| InChIKey | KALCCFXTRWUMGG-YQMBXKBSSA-N |
| XLogP | 3.32 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|