C26H37NO — CID 162906862
2-[[(5S,8S,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]iminomethyl]phenol (PubChem CID 162906862) has the molecular formula C26H37NO and a molecular weight of 379.59 g/mol. Its IUPAC name is 2-[[(5S,8S,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]iminomethyl]phenol.
| Compound Name | 2-[[(5S,8S,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 162906862 |
| Molecular Formula | C26H37NO |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | 2-[[(5S,8S,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]iminomethyl]phenol |
| SMILES | C[C@]12CCCC[C@H]1CC[C@H]1[C@@H]2CC[C@@]2(C)[C@H](/N=C/c3ccccc3O)CC[C@@H]12 |
| InChI | InChI=1S/C26H37NO/c1-25-15-6-5-8-19(25)10-11-20-21-12-13-24(26(21,2)16-14-22(20)25)27-17-18-7-3-4-9-23(18)28/h3-4,7,9,17,19-22,24,28H,5-6,8,10-16H2,1-2H3/b27-17+/t19-,20+,21-,22-,24+,25-,26+/m0/s1 |
| InChIKey | KCNVLMLASJSATC-ICKBRYRQSA-N |
| XLogP | 6.61 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|